C31H32O7S — CID 137498681
[(2R)-3-[bis(4-methoxyphenyl)-phenylmethoxy]-2-hydroxypropyl] 4-methylbenzenesulfonate (PubChem CID 137498681) has the molecular formula C31H32O7S and a molecular weight of 548.66 g/mol. Its IUPAC name is [(2R)-3-[bis(4-methoxyphenyl)-phenylmethoxy]-2-hydroxypropyl] 4-methylbenzenesulfonate.
| Compound Name | [(2R)-3-[bis(4-methoxyphenyl)-phenylmethoxy]-2-hydroxypropyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 137498681 |
| Molecular Formula | C31H32O7S |
| Molecular Weight | 548.66 g/mol |
| Exact Mass | 548.19 |
| IUPAC Name | [(2R)-3-[bis(4-methoxyphenyl)-phenylmethoxy]-2-hydroxypropyl] 4-methylbenzenesulfonate |
| SMILES | COc1ccc(C(OC[C@@H](O)COS(=O)(=O)c2ccc(C)cc2)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C31H32O7S/c1-23-9-19-30(20-10-23)39(33,34)38-22-27(32)21-37-31(24-7-5-4-6-8-24,25-11-15-28(35-2)16-12-25)26-13-17-29(36-3)18-14-26/h4-20,27,32H,21-22H2,1-3H3/t27-/m1/s1 |
| InChIKey | VQSLOAUYVNHCEN-HHHXNRCGSA-N |
| XLogP | 5.09 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.66 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|