C26H31NO4 — CID 135215406
1-[bis(4-methoxyphenyl)-phenylmethoxy]-3-(ethylamino)propan-2-ol (PubChem CID 135215406) has the molecular formula C26H31NO4 and a molecular weight of 421.54 g/mol. Its IUPAC name is 1-[bis(4-methoxyphenyl)-phenylmethoxy]-3-(ethylamino)propan-2-ol.
| Compound Name | 1-[bis(4-methoxyphenyl)-phenylmethoxy]-3-(ethylamino)propan-2-ol |
|---|---|
| PubChem CID | 135215406 |
| Molecular Formula | C26H31NO4 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | 1-[bis(4-methoxyphenyl)-phenylmethoxy]-3-(ethylamino)propan-2-ol |
| SMILES | CCNCC(O)COC(c1ccccc1)(c1ccc(OC)cc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C26H31NO4/c1-4-27-18-23(28)19-31-26(20-8-6-5-7-9-20,21-10-14-24(29-2)15-11-21)22-12-16-25(30-3)17-13-22/h5-17,23,27-28H,4,18-19H2,1-3H3 |
| InChIKey | FAKUHYBGSCKXQR-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|