C43H42N2O3 — CID 10579918
1,3-bis[[(4-methoxyphenyl)-diphenylmethyl]amino]propan-2-ol (PubChem CID 10579918) has the molecular formula C43H42N2O3 and a molecular weight of 634.82 g/mol. Its IUPAC name is 1,3-bis[[(4-methoxyphenyl)-diphenylmethyl]amino]propan-2-ol.
| Compound Name | 1,3-bis[[(4-methoxyphenyl)-diphenylmethyl]amino]propan-2-ol |
|---|---|
| PubChem CID | 10579918 |
| Molecular Formula | C43H42N2O3 |
| Molecular Weight | 634.82 g/mol |
| Exact Mass | 634.32 |
| IUPAC Name | 1,3-bis[[(4-methoxyphenyl)-diphenylmethyl]amino]propan-2-ol |
| SMILES | COc1ccc(C(NCC(O)CNC(c2ccccc2)(c2ccccc2)c2ccc(OC)cc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C43H42N2O3/c1-47-40-27-23-37(24-28-40)42(33-15-7-3-8-16-33,34-17-9-4-10-18-34)44-31-39(46)32-45-43(35-19-11-5-12-20-35,36-21-13-6-14-22-36)38-25-29-41(48-2)30-26-38/h3-30,39,44-46H,31-32H2,1-2H3 |
| InChIKey | QIUJGARBTVVJDB-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.82 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|