C25H27NO5 — CID 175799050
(2R,3S)-2-[[bis(4-methoxyphenyl)-phenylmethyl]amino]-3-hydroxybutanoic acid (PubChem CID 175799050) has the molecular formula C25H27NO5 and a molecular weight of 421.49 g/mol. Its IUPAC name is (2R,3S)-2-[[bis(4-methoxyphenyl)-phenylmethyl]amino]-3-hydroxybutanoic acid.
| Compound Name | (2R,3S)-2-[[bis(4-methoxyphenyl)-phenylmethyl]amino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 175799050 |
| Molecular Formula | C25H27NO5 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | (2R,3S)-2-[[bis(4-methoxyphenyl)-phenylmethyl]amino]-3-hydroxybutanoic acid |
| SMILES | COc1ccc(C(N[C@@H](C(=O)O)[C@H](C)O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C25H27NO5/c1-17(27)23(24(28)29)26-25(18-7-5-4-6-8-18,19-9-13-21(30-2)14-10-19)20-11-15-22(31-3)16-12-20/h4-17,23,26-27H,1-3H3,(H,28,29)/t17-,23+/m0/s1 |
| InChIKey | HFYIUHUEPGWSLV-GAJHUEQPSA-N |
| XLogP | 3.42 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|