C27H34N2O3 — CID 71741751
diethylazanium;(2S,3R)-3-hydroxy-2-(tritylamino)butanoate (PubChem CID 71741751) has the molecular formula C27H34N2O3 and a molecular weight of 434.58 g/mol. Its IUPAC name is diethylazanium;(2S,3R)-3-hydroxy-2-(tritylamino)butanoate.
| Compound Name | diethylazanium;(2S,3R)-3-hydroxy-2-(tritylamino)butanoate |
|---|---|
| PubChem CID | 71741751 |
| Molecular Formula | C27H34N2O3 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.26 |
| IUPAC Name | diethylazanium;(2S,3R)-3-hydroxy-2-(tritylamino)butanoate |
| SMILES | CC[NH2+]CC.C[C@@H](O)[C@H](NC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)[O-] |
| InChI | InChI=1S/C23H23NO3.C4H11N/c1-17(25)21(22(26)27)24-23(18-11-5-2-6-12-18,19-13-7-3-8-14-19)20-15-9-4-10-16-20;1-3-5-4-2/h2-17,21,24-25H,1H3,(H,26,27);5H,3-4H2,1-2H3/t17-,21+;/m1./s1 |
| InChIKey | WYYVJRBSJGUXSL-JKSHRDEXSA-N |
| XLogP | 1.66 |
| TPSA | 89.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|