About propanoate;trimethyl(trityl)phosphanium
propanoate;trimethyl(trityl)phosphanium (PubChem CID 18355979) has the molecular formula C25H29O2P
and a molecular weight of 392.48 g/mol. Its IUPAC name is propanoate;trimethyl(trityl)phosphanium.
Molecular Properties
| Compound Name | propanoate;trimethyl(trityl)phosphanium |
| PubChem CID | 18355979 |
| Molecular Formula | C25H29O2P |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | propanoate;trimethyl(trityl)phosphanium |
| SMILES | CCC(=O)[O-].C[P+](C)(C)C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H24P.C3H6O2/c1-23(2,3)22(19-13-7-4-8-14-19,20-15-9-5-10-16-20)21-17-11-6-12-18-21;1-2-3(4)5/h4-18H,1-3H3;2H2,1H3,(H,4,5)/q+1;/p-1 |
| InChIKey | GXOGVNKCNZEXGD-UHFFFAOYSA-M |
| XLogP | 5.03 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze propanoate;trimethyl(trityl)phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propanoate;trimethyl(trityl)phosphanium?
The IUPAC name of propanoate;trimethyl(trityl)phosphanium (CID 18355979) is propanoate;trimethyl(trityl)phosphanium.
What is the SMILES notation for propanoate;trimethyl(trityl)phosphanium?
The canonical SMILES for propanoate;trimethyl(trityl)phosphanium is CCC(=O)[O-].C[P+](C)(C)C(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of propanoate;trimethyl(trityl)phosphanium?
The InChIKey is GXOGVNKCNZEXGD-UHFFFAOYSA-M. The full InChI is InChI=1S/C22H24P.C3H6O2/c1-23(2,3)22(19-13-7-4-8-14-19,20-15-9-5-10-16-20)21-17-11-6-12-18-21;1-2-3(4)5/h4-18H,1-3H3;2H2,1H3,(H,4,5)/q+1;/p-1.
What are the key properties of propanoate;trimethyl(trityl)phosphanium?
propanoate;trimethyl(trityl)phosphanium has a molecular weight of 392.48 g/mol, XLogP of 5.03, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propanoate;trimethyl(trityl)phosphanium is sourced from PubChem (CID 18355979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).