C23H33NO — CID 144673539
6-(dimethylamino)-4,4-diphenylheptan-3-one;ethane (PubChem CID 144673539) has the molecular formula C23H33NO and a molecular weight of 339.52 g/mol. Its IUPAC name is 6-(dimethylamino)-4,4-diphenylheptan-3-one;ethane.
| Compound Name | 6-(dimethylamino)-4,4-diphenylheptan-3-one;ethane |
|---|---|
| PubChem CID | 144673539 |
| Molecular Formula | C23H33NO |
| Molecular Weight | 339.52 g/mol |
| Exact Mass | 339.26 |
| IUPAC Name | 6-(dimethylamino)-4,4-diphenylheptan-3-one;ethane |
| SMILES | CC.CCC(=O)C(CC(C)N(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H27NO.C2H6/c1-5-20(23)21(16-17(2)22(3)4,18-12-8-6-9-13-18)19-14-10-7-11-15-19;1-2/h6-15,17H,5,16H2,1-4H3;1-2H3 |
| InChIKey | BGGSRRZBXVQAIW-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.52 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |