C21H24F3NO — CID 164732602
(4S,6R)-6-(dimethylamino)-4-phenyl-4-(2,3,6-trifluorophenyl)heptan-3-one (PubChem CID 164732602) has the molecular formula C21H24F3NO and a molecular weight of 363.42 g/mol. Its IUPAC name is (4S,6R)-6-(dimethylamino)-4-phenyl-4-(2,3,6-trifluorophenyl)heptan-3-one.
| Compound Name | (4S,6R)-6-(dimethylamino)-4-phenyl-4-(2,3,6-trifluorophenyl)heptan-3-one |
|---|---|
| PubChem CID | 164732602 |
| Molecular Formula | C21H24F3NO |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | (4S,6R)-6-(dimethylamino)-4-phenyl-4-(2,3,6-trifluorophenyl)heptan-3-one |
| SMILES | CCC(=O)[C@@](C[C@@H](C)N(C)C)(c1ccccc1)c1c(F)ccc(F)c1F |
| InChI | InChI=1S/C21H24F3NO/c1-5-18(26)21(13-14(2)25(3)4,15-9-7-6-8-10-15)19-16(22)11-12-17(23)20(19)24/h6-12,14H,5,13H2,1-4H3/t14-,21-/m1/s1 |
| InChIKey | AGWHEFHXQPXQRZ-SPLOXXLWSA-N |
| XLogP | 4.71 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|