C26H33N3O — CID 174979637
6-(dimethylamino)-4,4-diphenylheptan-3-one;1-ethenylimidazole (PubChem CID 174979637) has the molecular formula C26H33N3O and a molecular weight of 403.57 g/mol. Its IUPAC name is 6-(dimethylamino)-4,4-diphenylheptan-3-one;1-ethenylimidazole.
| Compound Name | 6-(dimethylamino)-4,4-diphenylheptan-3-one;1-ethenylimidazole |
|---|---|
| PubChem CID | 174979637 |
| Molecular Formula | C26H33N3O |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.26 |
| IUPAC Name | 6-(dimethylamino)-4,4-diphenylheptan-3-one;1-ethenylimidazole |
| SMILES | C=Cn1ccnc1.CCC(=O)C(CC(C)N(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H27NO.C5H6N2/c1-5-20(23)21(16-17(2)22(3)4,18-12-8-6-9-13-18)19-14-10-7-11-15-19;1-2-7-4-3-6-5-7/h6-15,17H,5,16H2,1-4H3;2-5H,1H2 |
| InChIKey | IQPXTURVCBBNOT-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |