C25H34ClNO3 — CID 122684376
6-(dimethylamino)-4,4-diphenylheptan-3-one;2-methylprop-2-enoic acid;hydrochloride (PubChem CID 122684376) has the molecular formula C25H34ClNO3 and a molecular weight of 432.00 g/mol. Its IUPAC name is 6-(dimethylamino)-4,4-diphenylheptan-3-one;2-methylprop-2-enoic acid;hydrochloride.
| Compound Name | 6-(dimethylamino)-4,4-diphenylheptan-3-one;2-methylprop-2-enoic acid;hydrochloride |
|---|---|
| PubChem CID | 122684376 |
| Molecular Formula | C25H34ClNO3 |
| Molecular Weight | 432.00 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | 6-(dimethylamino)-4,4-diphenylheptan-3-one;2-methylprop-2-enoic acid;hydrochloride |
| SMILES | C=C(C)C(=O)O.CCC(=O)C(CC(C)N(C)C)(c1ccccc1)c1ccccc1.Cl |
| InChI | InChI=1S/C21H27NO.C4H6O2.ClH/c1-5-20(23)21(16-17(2)22(3)4,18-12-8-6-9-13-18)19-14-10-7-11-15-19;1-3(2)4(5)6;/h6-15,17H,5,16H2,1-4H3;1H2,2H3,(H,5,6);1H |
| InChIKey | GIZDXLFXXSYYEE-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.00 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|