C31H43N3O4 — CID 70561400
5-butan-2-yl-5-ethyl-1,3-diazinane-2,4,6-trione;6-(dimethylamino)-4,4-diphenylheptan-3-one (PubChem CID 70561400) has the molecular formula C31H43N3O4 and a molecular weight of 521.70 g/mol. Its IUPAC name is 5-butan-2-yl-5-ethyl-1,3-diazinane-2,4,6-trione;6-(dimethylamino)-4,4-diphenylheptan-3-one.
| Compound Name | 5-butan-2-yl-5-ethyl-1,3-diazinane-2,4,6-trione;6-(dimethylamino)-4,4-diphenylheptan-3-one |
|---|---|
| PubChem CID | 70561400 |
| Molecular Formula | C31H43N3O4 |
| Molecular Weight | 521.70 g/mol |
| Exact Mass | 521.33 |
| IUPAC Name | 5-butan-2-yl-5-ethyl-1,3-diazinane-2,4,6-trione;6-(dimethylamino)-4,4-diphenylheptan-3-one |
| SMILES | CCC(=O)C(CC(C)N(C)C)(c1ccccc1)c1ccccc1.CCC(C)C1(CC)C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C21H27NO.C10H16N2O3/c1-5-20(23)21(16-17(2)22(3)4,18-12-8-6-9-13-18)19-14-10-7-11-15-19;1-4-6(3)10(5-2)7(13)11-9(15)12-8(10)14/h6-15,17H,5,16H2,1-4H3;6H,4-5H2,1-3H3,(H2,11,12,13,14,15) |
| InChIKey | AAUFPJIBGYGEQE-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.70 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|