C20H25NO — CID 131842164
(6R)-6-(methylamino)-4,4-diphenylheptan-3-one (PubChem CID 131842164) has the molecular formula C20H25NO and a molecular weight of 295.43 g/mol. Its IUPAC name is (6R)-6-(methylamino)-4,4-diphenylheptan-3-one.
| Compound Name | (6R)-6-(methylamino)-4,4-diphenylheptan-3-one |
|---|---|
| PubChem CID | 131842164 |
| Molecular Formula | C20H25NO |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | (6R)-6-(methylamino)-4,4-diphenylheptan-3-one |
| SMILES | CCC(=O)C(C[C@@H](C)NC)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H25NO/c1-4-19(22)20(15-16(2)21-3,17-11-7-5-8-12-17)18-13-9-6-10-14-18/h5-14,16,21H,4,15H2,1-3H3/t16-/m1/s1 |
| InChIKey | CXNCTGHWIPMHGB-MRXNPFEDSA-N |
| XLogP | 3.95 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |