C24H34NO+ — CID 164732553
dimethyl-[(4S)-2-methyl-7-oxo-6,6-diphenylnonan-4-yl]azanium (PubChem CID 164732553) has the molecular formula C24H34NO+ and a molecular weight of 352.54 g/mol. Its IUPAC name is dimethyl-[(4S)-2-methyl-7-oxo-6,6-diphenylnonan-4-yl]azanium.
| Compound Name | dimethyl-[(4S)-2-methyl-7-oxo-6,6-diphenylnonan-4-yl]azanium |
|---|---|
| PubChem CID | 164732553 |
| Molecular Formula | C24H34NO+ |
| Molecular Weight | 352.54 g/mol |
| Exact Mass | 352.26 |
| IUPAC Name | dimethyl-[(4S)-2-methyl-7-oxo-6,6-diphenylnonan-4-yl]azanium |
| SMILES | CCC(=O)C(C[C@H](CC(C)C)[NH+](C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H33NO/c1-6-23(26)24(20-13-9-7-10-14-20,21-15-11-8-12-16-21)18-22(25(4)5)17-19(2)3/h7-16,19,22H,6,17-18H2,1-5H3/p+1/t22-/m0/s1 |
| InChIKey | GTBXHWAISFROHE-QFIPXVFZSA-O |
| XLogP | 3.90 |
| TPSA | 21.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.54 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |