C23H29NO3 — CID 164732652
(4R)-4-(dimethylamino)-7-oxo-6,6-diphenylnonanoic acid (PubChem CID 164732652) has the molecular formula C23H29NO3 and a molecular weight of 367.49 g/mol. Its IUPAC name is (4R)-4-(dimethylamino)-7-oxo-6,6-diphenylnonanoic acid.
| Compound Name | (4R)-4-(dimethylamino)-7-oxo-6,6-diphenylnonanoic acid |
|---|---|
| PubChem CID | 164732652 |
| Molecular Formula | C23H29NO3 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | (4R)-4-(dimethylamino)-7-oxo-6,6-diphenylnonanoic acid |
| SMILES | CCC(=O)C(C[C@@H](CCC(=O)O)N(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H29NO3/c1-4-21(25)23(18-11-7-5-8-12-18,19-13-9-6-10-14-19)17-20(24(2)3)15-16-22(26)27/h5-14,20H,4,15-17H2,1-3H3,(H,26,27)/t20-/m1/s1 |
| InChIKey | CNHYBWBPLIKCCV-HXUWFJFHSA-N |
| XLogP | 4.14 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |