C24H29N3O — CID 154665875
(6R)-6-(dimethylamino)-7-(1H-imidazol-5-yl)-4,4-diphenylheptan-3-one (PubChem CID 154665875) has the molecular formula C24H29N3O and a molecular weight of 375.52 g/mol. Its IUPAC name is (6R)-6-(dimethylamino)-7-(1H-imidazol-5-yl)-4,4-diphenylheptan-3-one.
| Compound Name | (6R)-6-(dimethylamino)-7-(1H-imidazol-5-yl)-4,4-diphenylheptan-3-one |
|---|---|
| PubChem CID | 154665875 |
| Molecular Formula | C24H29N3O |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | (6R)-6-(dimethylamino)-7-(1H-imidazol-5-yl)-4,4-diphenylheptan-3-one |
| SMILES | CCC(=O)C(C[C@H](Cc1cnc[nH]1)N(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H29N3O/c1-4-23(28)24(19-11-7-5-8-12-19,20-13-9-6-10-14-20)16-22(27(2)3)15-21-17-25-18-26-21/h5-14,17-18,22H,4,15-16H2,1-3H3,(H,25,26)/t22-/m0/s1 |
| InChIKey | IPQCIEATMNGXFD-QFIPXVFZSA-N |
| XLogP | 4.24 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |