C21H28INO — CID 171389978
6-(dimethylamino)-4,4-diphenylheptan-3-one;hydroiodide (PubChem CID 171389978) has the molecular formula C21H28INO and a molecular weight of 437.37 g/mol. Its IUPAC name is 6-(dimethylamino)-4,4-diphenylheptan-3-one;hydroiodide.
| Compound Name | 6-(dimethylamino)-4,4-diphenylheptan-3-one;hydroiodide |
|---|---|
| PubChem CID | 171389978 |
| Molecular Formula | C21H28INO |
| Molecular Weight | 437.37 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | 6-(dimethylamino)-4,4-diphenylheptan-3-one;hydroiodide |
| SMILES | CCC(=O)C(CC(C)N(C)C)(c1ccccc1)c1ccccc1.I |
| InChI | InChI=1S/C21H27NO.HI/c1-5-20(23)21(16-17(2)22(3)4,18-12-8-6-9-13-18)19-14-10-7-11-15-19;/h6-15,17H,5,16H2,1-4H3;1H |
| InChIKey | BUQLQYUUFYFANQ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.37 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|