C22H25NO — CID 154665818
(7S)-7-(dimethylamino)-5,5-diphenyloct-1-yn-4-one (PubChem CID 154665818) has the molecular formula C22H25NO and a molecular weight of 319.45 g/mol. Its IUPAC name is (7S)-7-(dimethylamino)-5,5-diphenyloct-1-yn-4-one.
| Compound Name | (7S)-7-(dimethylamino)-5,5-diphenyloct-1-yn-4-one |
|---|---|
| PubChem CID | 154665818 |
| Molecular Formula | C22H25NO |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | (7S)-7-(dimethylamino)-5,5-diphenyloct-1-yn-4-one |
| SMILES | C#CCC(=O)C(C[C@H](C)N(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H25NO/c1-5-12-21(24)22(17-18(2)23(3)4,19-13-8-6-9-14-19)20-15-10-7-11-16-20/h1,6-11,13-16,18H,12,17H2,2-4H3/t18-/m0/s1 |
| InChIKey | LLLMACFEYMJBLW-SFHVURJKSA-N |
| XLogP | 3.91 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|