C27H31NO — CID 154665815
(4S)-4-(dimethylamino)-1-(4-ethylphenyl)-2,2-diphenylpentan-1-one (PubChem CID 154665815) has the molecular formula C27H31NO and a molecular weight of 385.55 g/mol. Its IUPAC name is (4S)-4-(dimethylamino)-1-(4-ethylphenyl)-2,2-diphenylpentan-1-one.
| Compound Name | (4S)-4-(dimethylamino)-1-(4-ethylphenyl)-2,2-diphenylpentan-1-one |
|---|---|
| PubChem CID | 154665815 |
| Molecular Formula | C27H31NO |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | (4S)-4-(dimethylamino)-1-(4-ethylphenyl)-2,2-diphenylpentan-1-one |
| SMILES | CCc1ccc(C(=O)C(C[C@H](C)N(C)C)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H31NO/c1-5-22-16-18-23(19-17-22)26(29)27(20-21(2)28(3)4,24-12-8-6-9-13-24)25-14-10-7-11-15-25/h6-19,21H,5,20H2,1-4H3/t21-/m0/s1 |
| InChIKey | JWTPZPOMKSNKIF-NRFANRHFSA-N |
| XLogP | 5.76 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |