C22H31ClN2O — CID 3032186
4-(dimethylamino)-2,2-diphenyl-N-propan-2-ylpentanamide;hydrochloride (PubChem CID 3032186) has the molecular formula C22H31ClN2O and a molecular weight of 374.96 g/mol. Its IUPAC name is 4-(dimethylamino)-2,2-diphenyl-N-propan-2-ylpentanamide;hydrochloride.
| Compound Name | 4-(dimethylamino)-2,2-diphenyl-N-propan-2-ylpentanamide;hydrochloride |
|---|---|
| PubChem CID | 3032186 |
| Molecular Formula | C22H31ClN2O |
| Molecular Weight | 374.96 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | 4-(dimethylamino)-2,2-diphenyl-N-propan-2-ylpentanamide;hydrochloride |
| SMILES | CC(C)NC(=O)C(CC(C)N(C)C)(c1ccccc1)c1ccccc1.Cl |
| InChI | InChI=1S/C22H30N2O.ClH/c1-17(2)23-21(25)22(16-18(3)24(4)5,19-12-8-6-9-13-19)20-14-10-7-11-15-20;/h6-15,17-18H,16H2,1-5H3,(H,23,25);1H |
| InChIKey | HKBSFGPFAYMXJL-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.96 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |