C23H31NO2 — CID 67318933
(3S,6S)-6-(dimethylamino)-3-ethyl-4,4-diphenylheptanoic acid (PubChem CID 67318933) has the molecular formula C23H31NO2 and a molecular weight of 353.51 g/mol. Its IUPAC name is (3S,6S)-6-(dimethylamino)-3-ethyl-4,4-diphenylheptanoic acid.
| Compound Name | (3S,6S)-6-(dimethylamino)-3-ethyl-4,4-diphenylheptanoic acid |
|---|---|
| PubChem CID | 67318933 |
| Molecular Formula | C23H31NO2 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.24 |
| IUPAC Name | (3S,6S)-6-(dimethylamino)-3-ethyl-4,4-diphenylheptanoic acid |
| SMILES | CCC(CC(=O)O)C(C[C@H](C)N(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H31NO2/c1-5-19(16-22(25)26)23(17-18(2)24(3)4,20-12-8-6-9-13-20)21-14-10-7-11-15-21/h6-15,18-19H,5,16-17H2,1-4H3,(H,25,26)/t18-,19?/m0/s1 |
| InChIKey | WFFGDYDMDTYBNG-OYKVQYDMSA-N |
| XLogP | 4.81 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |