C19H24N2O — CID 51382597
(4R)-4-(dimethylamino)-2,2-diphenylpentanamide (PubChem CID 51382597) has the molecular formula C19H24N2O and a molecular weight of 296.41 g/mol. Its IUPAC name is (4R)-4-(dimethylamino)-2,2-diphenylpentanamide.
| Compound Name | (4R)-4-(dimethylamino)-2,2-diphenylpentanamide |
|---|---|
| PubChem CID | 51382597 |
| Molecular Formula | C19H24N2O |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | (4R)-4-(dimethylamino)-2,2-diphenylpentanamide |
| SMILES | C[C@H](CC(C(N)=O)(c1ccccc1)c1ccccc1)N(C)C |
| InChI | InChI=1S/C19H24N2O/c1-15(21(2)3)14-19(18(20)22,16-10-6-4-7-11-16)17-12-8-5-9-13-17/h4-13,15H,14H2,1-3H3,(H2,20,22)/t15-/m1/s1 |
| InChIKey | NARHAGIVSFTMIG-OAHLLOKOSA-N |
| XLogP | 2.80 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |