C21H27NO — CID 54516525
6-(dimethylamino)-4,4-diphenylheptan-2-one (PubChem CID 54516525) has the molecular formula C21H27NO and a molecular weight of 309.45 g/mol. Its IUPAC name is 6-(dimethylamino)-4,4-diphenylheptan-2-one.
| Compound Name | 6-(dimethylamino)-4,4-diphenylheptan-2-one |
|---|---|
| PubChem CID | 54516525 |
| Molecular Formula | C21H27NO |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | 6-(dimethylamino)-4,4-diphenylheptan-2-one |
| SMILES | CC(=O)CC(CC(C)N(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H27NO/c1-17(22(3)4)15-21(16-18(2)23,19-11-7-5-8-12-19)20-13-9-6-10-14-20/h5-14,17H,15-16H2,1-4H3 |
| InChIKey | YMULZGRFUQNWDT-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |