C23H30NO2- — CID 23616922
6-(dimethylamino)-3-ethyl-4,4-diphenylheptanoate (PubChem CID 23616922) has the molecular formula C23H30NO2- and a molecular weight of 352.50 g/mol. Its IUPAC name is 6-(dimethylamino)-3-ethyl-4,4-diphenylheptanoate.
| Compound Name | 6-(dimethylamino)-3-ethyl-4,4-diphenylheptanoate |
|---|---|
| PubChem CID | 23616922 |
| Molecular Formula | C23H30NO2- |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.23 |
| IUPAC Name | 6-(dimethylamino)-3-ethyl-4,4-diphenylheptanoate |
| SMILES | CCC(CC(=O)[O-])C(CC(C)N(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H31NO2/c1-5-19(16-22(25)26)23(17-18(2)24(3)4,20-12-8-6-9-13-20)21-14-10-7-11-15-21/h6-15,18-19H,5,16-17H2,1-4H3,(H,25,26)/p-1 |
| InChIKey | WFFGDYDMDTYBNG-UHFFFAOYSA-M |
| XLogP | 3.48 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |