C43H56N2O — CID 174656591
2,10-bis(dimethylamino)-5,7-diethyl-4,4,8,8-tetraphenylundecan-6-one (PubChem CID 174656591) has the molecular formula C43H56N2O and a molecular weight of 616.93 g/mol. Its IUPAC name is 2,10-bis(dimethylamino)-5,7-diethyl-4,4,8,8-tetraphenylundecan-6-one.
| Compound Name | 2,10-bis(dimethylamino)-5,7-diethyl-4,4,8,8-tetraphenylundecan-6-one |
|---|---|
| PubChem CID | 174656591 |
| Molecular Formula | C43H56N2O |
| Molecular Weight | 616.93 g/mol |
| Exact Mass | 616.44 |
| IUPAC Name | 2,10-bis(dimethylamino)-5,7-diethyl-4,4,8,8-tetraphenylundecan-6-one |
| SMILES | CCC(C(=O)C(CC)C(CC(C)N(C)C)(c1ccccc1)c1ccccc1)C(CC(C)N(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C43H56N2O/c1-9-39(42(31-33(3)44(5)6,35-23-15-11-16-24-35)36-25-17-12-18-26-36)41(46)40(10-2)43(32-34(4)45(7)8,37-27-19-13-20-28-37)38-29-21-14-22-30-38/h11-30,33-34,39-40H,9-10,31-32H2,1-8H3 |
| InChIKey | LNILTNMLPIJYEP-UHFFFAOYSA-N |
| XLogP | 9.26 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.93 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |