C21H30ClNO — CID 21127624
(3S,6R)-6-(dimethylamino)-4,4-diphenylheptan-3-ol;hydrochloride (PubChem CID 21127624) has the molecular formula C21H30ClNO and a molecular weight of 347.93 g/mol. Its IUPAC name is (3S,6R)-6-(dimethylamino)-4,4-diphenylheptan-3-ol;hydrochloride.
| Compound Name | (3S,6R)-6-(dimethylamino)-4,4-diphenylheptan-3-ol;hydrochloride |
|---|---|
| PubChem CID | 21127624 |
| Molecular Formula | C21H30ClNO |
| Molecular Weight | 347.93 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | (3S,6R)-6-(dimethylamino)-4,4-diphenylheptan-3-ol;hydrochloride |
| SMILES | CC[C@H](O)C(C[C@@H](C)N(C)C)(c1ccccc1)c1ccccc1.Cl |
| InChI | InChI=1S/C21H29NO.ClH/c1-5-20(23)21(16-17(2)22(3)4,18-12-8-6-9-13-18)19-14-10-7-11-15-19;/h6-15,17,20,23H,5,16H2,1-4H3;1H/t17-,20+;/m1./s1 |
| InChIKey | GMNBUMFCZAZBQG-XLCHORMMSA-N |
| XLogP | 4.51 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.93 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |