C19H24ClNO — CID 175870176
5-methyl-2,2-diphenylhexanamide;hydrochloride (PubChem CID 175870176) has the molecular formula C19H24ClNO and a molecular weight of 317.86 g/mol. Its IUPAC name is 5-methyl-2,2-diphenylhexanamide;hydrochloride.
| Compound Name | 5-methyl-2,2-diphenylhexanamide;hydrochloride |
|---|---|
| PubChem CID | 175870176 |
| Molecular Formula | C19H24ClNO |
| Molecular Weight | 317.86 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | 5-methyl-2,2-diphenylhexanamide;hydrochloride |
| SMILES | CC(C)CCC(C(N)=O)(c1ccccc1)c1ccccc1.Cl |
| InChI | InChI=1S/C19H23NO.ClH/c1-15(2)13-14-19(18(20)21,16-9-5-3-6-10-16)17-11-7-4-8-12-17;/h3-12,15H,13-14H2,1-2H3,(H2,20,21);1H |
| InChIKey | IKGGJNVOHLXJQI-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.86 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |