C20H24O2 — CID 141362939
6-methyl-2,2-diphenylheptanoic acid (PubChem CID 141362939) has the molecular formula C20H24O2 and a molecular weight of 296.41 g/mol. Its IUPAC name is 6-methyl-2,2-diphenylheptanoic acid.
| Compound Name | 6-methyl-2,2-diphenylheptanoic acid |
|---|---|
| PubChem CID | 141362939 |
| Molecular Formula | C20H24O2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | 6-methyl-2,2-diphenylheptanoic acid |
| SMILES | CC(C)CCCC(C(=O)O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H24O2/c1-16(2)10-9-15-20(19(21)22,17-11-5-3-6-12-17)18-13-7-4-8-14-18/h3-8,11-14,16H,9-10,15H2,1-2H3,(H,21,22) |
| InChIKey | DRLCSKHNGSSDSW-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |