C16H24O2 — CID 83158043
2-ethyl-6-methyl-2-phenylheptanoic acid (PubChem CID 83158043) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is 2-ethyl-6-methyl-2-phenylheptanoic acid.
| Compound Name | 2-ethyl-6-methyl-2-phenylheptanoic acid |
|---|---|
| PubChem CID | 83158043 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | 2-ethyl-6-methyl-2-phenylheptanoic acid |
| SMILES | CCC(CCCC(C)C)(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C16H24O2/c1-4-16(15(17)18,12-8-9-13(2)3)14-10-6-5-7-11-14/h5-7,10-11,13H,4,8-9,12H2,1-3H3,(H,17,18) |
| InChIKey | KUEOIEVLSYUTJU-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |