C20H36O2 — CID 159895945
3,7-dimethyloctan-3-ol;2-phenylbutan-2-ol (PubChem CID 159895945) has the molecular formula C20H36O2 and a molecular weight of 308.51 g/mol. Its IUPAC name is 3,7-dimethyloctan-3-ol;2-phenylbutan-2-ol.
| Compound Name | 3,7-dimethyloctan-3-ol;2-phenylbutan-2-ol |
|---|---|
| PubChem CID | 159895945 |
| Molecular Formula | C20H36O2 |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.27 |
| IUPAC Name | 3,7-dimethyloctan-3-ol;2-phenylbutan-2-ol |
| SMILES | CCC(C)(O)CCCC(C)C.CCC(C)(O)c1ccccc1 |
| InChI | InChI=1S/C10H14O.C10H22O/c1-3-10(2,11)9-7-5-4-6-8-9;1-5-10(4,11)8-6-7-9(2)3/h4-8,11H,3H2,1-2H3;9,11H,5-8H2,1-4H3 |
| InChIKey | NVIPHYYBWXNBJB-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |