C20H26O2P+ — CID 172710427
hydroxy-(6-methyl-1,1-diphenylheptyl)-oxophosphanium (PubChem CID 172710427) has the molecular formula C20H26O2P+ and a molecular weight of 329.40 g/mol. Its IUPAC name is hydroxy-(6-methyl-1,1-diphenylheptyl)-oxophosphanium.
| Compound Name | hydroxy-(6-methyl-1,1-diphenylheptyl)-oxophosphanium |
|---|---|
| PubChem CID | 172710427 |
| Molecular Formula | C20H26O2P+ |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | hydroxy-(6-methyl-1,1-diphenylheptyl)-oxophosphanium |
| SMILES | CC(C)CCCCC(c1ccccc1)(c1ccccc1)[P+](=O)O |
| InChI | InChI=1S/C20H25O2P/c1-17(2)11-9-10-16-20(23(21)22,18-12-5-3-6-13-18)19-14-7-4-8-15-19/h3-8,12-15,17H,9-11,16H2,1-2H3/p+1 |
| InChIKey | PJDOGMKMCHDZCY-UHFFFAOYSA-O |
| XLogP | 5.88 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|