C24H42NOP — CID 67607946
N,N-bis(2-methylpropyl)-2-phenyl-2-phosphanyldecanamide (PubChem CID 67607946) has the molecular formula C24H42NOP and a molecular weight of 391.58 g/mol. Its IUPAC name is N,N-bis(2-methylpropyl)-2-phenyl-2-phosphanyldecanamide.
| Compound Name | N,N-bis(2-methylpropyl)-2-phenyl-2-phosphanyldecanamide |
|---|---|
| PubChem CID | 67607946 |
| Molecular Formula | C24H42NOP |
| Molecular Weight | 391.58 g/mol |
| Exact Mass | 391.30 |
| IUPAC Name | N,N-bis(2-methylpropyl)-2-phenyl-2-phosphanyldecanamide |
| SMILES | CCCCCCCCC(P)(C(=O)N(CC(C)C)CC(C)C)c1ccccc1 |
| InChI | InChI=1S/C24H42NOP/c1-6-7-8-9-10-14-17-24(27,22-15-12-11-13-16-22)23(26)25(18-20(2)3)19-21(4)5/h11-13,15-16,20-21H,6-10,14,17-19,27H2,1-5H3 |
| InChIKey | BJZOAISOMLNCKV-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.58 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|