C20H26O2P+ — CID 154061823
(6-methyl-1,1-diphenylheptoxy)-oxophosphanium (PubChem CID 154061823) has the molecular formula C20H26O2P+ and a molecular weight of 329.40 g/mol. Its IUPAC name is (6-methyl-1,1-diphenylheptoxy)-oxophosphanium.
| Compound Name | (6-methyl-1,1-diphenylheptoxy)-oxophosphanium |
|---|---|
| PubChem CID | 154061823 |
| Molecular Formula | C20H26O2P+ |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | (6-methyl-1,1-diphenylheptoxy)-oxophosphanium |
| SMILES | CC(C)CCCCC(O[PH+]=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H26O2P/c1-17(2)11-9-10-16-20(22-23-21,18-12-5-3-6-13-18)19-14-7-4-8-15-19/h3-8,12-15,17,23H,9-11,16H2,1-2H3/q+1 |
| InChIKey | WLGLQCSSPGUMSQ-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|