C18H23OPS2 — CID 54190731
1,1-diphenylhexoxy-bis(sulfanyl)phosphane (PubChem CID 54190731) has the molecular formula C18H23OPS2 and a molecular weight of 350.49 g/mol. Its IUPAC name is 1,1-diphenylhexoxy-bis(sulfanyl)phosphane.
| Compound Name | 1,1-diphenylhexoxy-bis(sulfanyl)phosphane |
|---|---|
| PubChem CID | 54190731 |
| Molecular Formula | C18H23OPS2 |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 1,1-diphenylhexoxy-bis(sulfanyl)phosphane |
| SMILES | CCCCCC(OP(S)S)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H23OPS2/c1-2-3-10-15-18(19-20(21)22,16-11-6-4-7-12-16)17-13-8-5-9-14-17/h4-9,11-14,21-22H,2-3,10,15H2,1H3 |
| InChIKey | PIHZRJPGEQEBRV-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|