C22H31PS3 — CID 54059108
1,1-diphenyldecylsulfanyl-bis(sulfanyl)phosphane (PubChem CID 54059108) has the molecular formula C22H31PS3 and a molecular weight of 422.67 g/mol. Its IUPAC name is 1,1-diphenyldecylsulfanyl-bis(sulfanyl)phosphane.
| Compound Name | 1,1-diphenyldecylsulfanyl-bis(sulfanyl)phosphane |
|---|---|
| PubChem CID | 54059108 |
| Molecular Formula | C22H31PS3 |
| Molecular Weight | 422.67 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | 1,1-diphenyldecylsulfanyl-bis(sulfanyl)phosphane |
| SMILES | CCCCCCCCCC(SP(S)S)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H31PS3/c1-2-3-4-5-6-7-14-19-22(26-23(24)25,20-15-10-8-11-16-20)21-17-12-9-13-18-21/h8-13,15-18,24-25H,2-7,14,19H2,1H3 |
| InChIKey | LYJMQRDJUPMLPE-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.67 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|