C40H48N2O4 — CID 170636634
6-[(5-carboxy-5,5-diphenylpentyl)-[2-(dimethylamino)ethyl]amino]-2,2-diphenylhexanoic acid (PubChem CID 170636634) has the molecular formula C40H48N2O4 and a molecular weight of 620.83 g/mol. Its IUPAC name is 6-[(5-carboxy-5,5-diphenylpentyl)-[2-(dimethylamino)ethyl]amino]-2,2-diphenylhexanoic acid.
| Compound Name | 6-[(5-carboxy-5,5-diphenylpentyl)-[2-(dimethylamino)ethyl]amino]-2,2-diphenylhexanoic acid |
|---|---|
| PubChem CID | 170636634 |
| Molecular Formula | C40H48N2O4 |
| Molecular Weight | 620.83 g/mol |
| Exact Mass | 620.36 |
| IUPAC Name | 6-[(5-carboxy-5,5-diphenylpentyl)-[2-(dimethylamino)ethyl]amino]-2,2-diphenylhexanoic acid |
| SMILES | CN(C)CCN(CCCCC(C(=O)O)(c1ccccc1)c1ccccc1)CCCCC(C(=O)O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H48N2O4/c1-41(2)31-32-42(29-17-15-27-39(37(43)44,33-19-7-3-8-20-33)34-21-9-4-10-22-34)30-18-16-28-40(38(45)46,35-23-11-5-12-24-35)36-25-13-6-14-26-36/h3-14,19-26H,15-18,27-32H2,1-2H3,(H,43,44)(H,45,46) |
| InChIKey | OHPJMZPCXMGVTP-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.83 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|