C22H28Cl2N2O — CID 11524308
4-[bis(2-chloroethyl)amino]-N,N-dimethyl-2,2-diphenylbutanamide (PubChem CID 11524308) has the molecular formula C22H28Cl2N2O and a molecular weight of 407.39 g/mol. Its IUPAC name is 4-[bis(2-chloroethyl)amino]-N,N-dimethyl-2,2-diphenylbutanamide.
| Compound Name | 4-[bis(2-chloroethyl)amino]-N,N-dimethyl-2,2-diphenylbutanamide |
|---|---|
| PubChem CID | 11524308 |
| Molecular Formula | C22H28Cl2N2O |
| Molecular Weight | 407.39 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 4-[bis(2-chloroethyl)amino]-N,N-dimethyl-2,2-diphenylbutanamide |
| SMILES | CN(C)C(=O)C(CCN(CCCl)CCCl)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H28Cl2N2O/c1-25(2)21(27)22(19-9-5-3-6-10-19,20-11-7-4-8-12-20)13-16-26(17-14-23)18-15-24/h3-12H,13-18H2,1-2H3 |
| InChIKey | MEMMMQLCUZFLLK-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.39 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|