C19H22ClNO3 — CID 6453495
2-[2-chloroethyl(methyl)amino]ethyl 2-hydroxy-2,2-diphenylacetate (PubChem CID 6453495) has the molecular formula C19H22ClNO3 and a molecular weight of 347.84 g/mol. Its IUPAC name is 2-[2-chloroethyl(methyl)amino]ethyl 2-hydroxy-2,2-diphenylacetate.
| Compound Name | 2-[2-chloroethyl(methyl)amino]ethyl 2-hydroxy-2,2-diphenylacetate |
|---|---|
| PubChem CID | 6453495 |
| Molecular Formula | C19H22ClNO3 |
| Molecular Weight | 347.84 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 2-[2-chloroethyl(methyl)amino]ethyl 2-hydroxy-2,2-diphenylacetate |
| SMILES | CN(CCCl)CCOC(=O)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H22ClNO3/c1-21(13-12-20)14-15-24-18(22)19(23,16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-11,23H,12-15H2,1H3 |
| InChIKey | QMMKHOXGBKDMKE-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.84 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|