C21H27NO3S — CID 117067116
2-(diethylamino)ethyl 2-hydroxy-2-(2-methylsulfanylphenyl)-2-phenylacetate (PubChem CID 117067116) has the molecular formula C21H27NO3S and a molecular weight of 373.52 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 2-hydroxy-2-(2-methylsulfanylphenyl)-2-phenylacetate.
| Compound Name | 2-(diethylamino)ethyl 2-hydroxy-2-(2-methylsulfanylphenyl)-2-phenylacetate |
|---|---|
| PubChem CID | 117067116 |
| Molecular Formula | C21H27NO3S |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | 2-(diethylamino)ethyl 2-hydroxy-2-(2-methylsulfanylphenyl)-2-phenylacetate |
| SMILES | CCN(CC)CCOC(=O)C(O)(c1ccccc1)c1ccccc1SC |
| InChI | InChI=1S/C21H27NO3S/c1-4-22(5-2)15-16-25-20(23)21(24,17-11-7-6-8-12-17)18-13-9-10-14-19(18)26-3/h6-14,24H,4-5,15-16H2,1-3H3 |
| InChIKey | BYNDSECCYXOACX-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |