C18H30ClNO3 — CID 20833921
2-(diethylamino)ethyl 2-hydroxy-4-methyl-2-phenylpentanoate;hydrochloride (PubChem CID 20833921) has the molecular formula C18H30ClNO3 and a molecular weight of 343.90 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 2-hydroxy-4-methyl-2-phenylpentanoate;hydrochloride.
| Compound Name | 2-(diethylamino)ethyl 2-hydroxy-4-methyl-2-phenylpentanoate;hydrochloride |
|---|---|
| PubChem CID | 20833921 |
| Molecular Formula | C18H30ClNO3 |
| Molecular Weight | 343.90 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | 2-(diethylamino)ethyl 2-hydroxy-4-methyl-2-phenylpentanoate;hydrochloride |
| SMILES | CCN(CC)CCOC(=O)C(O)(CC(C)C)c1ccccc1.Cl |
| InChI | InChI=1S/C18H29NO3.ClH/c1-5-19(6-2)12-13-22-17(20)18(21,14-15(3)4)16-10-8-7-9-11-16;/h7-11,15,21H,5-6,12-14H2,1-4H3;1H |
| InChIKey | FPACDZHXTXLIBG-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.90 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |