C24H33NO2 — CID 10406675
2-(diethylamino)ethyl 4-methyl-2,2-diphenylpentanoate (PubChem CID 10406675) has the molecular formula C24H33NO2 and a molecular weight of 367.53 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 4-methyl-2,2-diphenylpentanoate.
| Compound Name | 2-(diethylamino)ethyl 4-methyl-2,2-diphenylpentanoate |
|---|---|
| PubChem CID | 10406675 |
| Molecular Formula | C24H33NO2 |
| Molecular Weight | 367.53 g/mol |
| Exact Mass | 367.25 |
| IUPAC Name | 2-(diethylamino)ethyl 4-methyl-2,2-diphenylpentanoate |
| SMILES | CCN(CC)CCOC(=O)C(CC(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H33NO2/c1-5-25(6-2)17-18-27-23(26)24(19-20(3)4,21-13-9-7-10-14-21)22-15-11-8-12-16-22/h7-16,20H,5-6,17-19H2,1-4H3 |
| InChIKey | UBAKENDNJJBKLH-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.53 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |