About ethane;2-[ethyl(propyl)amino]ethyl 2-ethyl-2,4-dimethylpentanoate
ethane;2-[ethyl(propyl)amino]ethyl 2-ethyl-2,4-dimethylpentanoate (PubChem CID 142590813) has the molecular formula C20H45NO2
and a molecular weight of 331.59 g/mol. Its IUPAC name is ethane;2-[ethyl(propyl)amino]ethyl 2-ethyl-2,4-dimethylpentanoate.
Molecular Properties
| Compound Name | ethane;2-[ethyl(propyl)amino]ethyl 2-ethyl-2,4-dimethylpentanoate |
| PubChem CID | 142590813 |
| Molecular Formula | C20H45NO2 |
| Molecular Weight | 331.59 g/mol |
| Exact Mass | 331.35 |
| IUPAC Name | ethane;2-[ethyl(propyl)amino]ethyl 2-ethyl-2,4-dimethylpentanoate |
| SMILES | CC.CC.CCCN(CC)CCOC(=O)C(C)(CC)CC(C)C |
| InChI | InChI=1S/C16H33NO2.2C2H6/c1-7-10-17(9-3)11-12-19-15(18)16(6,8-2)13-14(4)5;2*1-2/h14H,7-13H2,1-6H3;2*1-2H3 |
| InChIKey | HSFYWMORYHTJCR-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 331.59 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;2-[ethyl(propyl)amino]ethyl 2-ethyl-2,4-dimethylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-[ethyl(propyl)amino]ethyl 2-ethyl-2,4-dimethylpentanoate?
The IUPAC name of ethane;2-[ethyl(propyl)amino]ethyl 2-ethyl-2,4-dimethylpentanoate (CID 142590813) is ethane;2-[ethyl(propyl)amino]ethyl 2-ethyl-2,4-dimethylpentanoate.
What is the SMILES notation for ethane;2-[ethyl(propyl)amino]ethyl 2-ethyl-2,4-dimethylpentanoate?
The canonical SMILES for ethane;2-[ethyl(propyl)amino]ethyl 2-ethyl-2,4-dimethylpentanoate is CC.CC.CCCN(CC)CCOC(=O)C(C)(CC)CC(C)C.
What is the InChIKey of ethane;2-[ethyl(propyl)amino]ethyl 2-ethyl-2,4-dimethylpentanoate?
The InChIKey is HSFYWMORYHTJCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H33NO2.2C2H6/c1-7-10-17(9-3)11-12-19-15(18)16(6,8-2)13-14(4)5;2*1-2/h14H,7-13H2,1-6H3;2*1-2H3.
What are the key properties of ethane;2-[ethyl(propyl)amino]ethyl 2-ethyl-2,4-dimethylpentanoate?
ethane;2-[ethyl(propyl)amino]ethyl 2-ethyl-2,4-dimethylpentanoate has a molecular weight of 331.59 g/mol, XLogP of 5.78, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-[ethyl(propyl)amino]ethyl 2-ethyl-2,4-dimethylpentanoate is sourced from PubChem (CID 142590813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).