C16H30O3 — CID 134286062
cyclohexyloxymethyl 2-ethyl-2,4-dimethylpentanoate (PubChem CID 134286062) has the molecular formula C16H30O3 and a molecular weight of 270.41 g/mol. Its IUPAC name is cyclohexyloxymethyl 2-ethyl-2,4-dimethylpentanoate.
| Compound Name | cyclohexyloxymethyl 2-ethyl-2,4-dimethylpentanoate |
|---|---|
| PubChem CID | 134286062 |
| Molecular Formula | C16H30O3 |
| Molecular Weight | 270.41 g/mol |
| Exact Mass | 270.22 |
| IUPAC Name | cyclohexyloxymethyl 2-ethyl-2,4-dimethylpentanoate |
| SMILES | CCC(C)(CC(C)C)C(=O)OCOC1CCCCC1 |
| InChI | InChI=1S/C16H30O3/c1-5-16(4,11-13(2)3)15(17)19-12-18-14-9-7-6-8-10-14/h13-14H,5-12H2,1-4H3 |
| InChIKey | NPWWPDYGCSFFNS-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.41 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|