C23H44O3 — CID 144560546
(1-cyclohexyloxy-3,3-dimethylbutyl) 2-tert-butyl-2,4-dimethylpentanoate (PubChem CID 144560546) has the molecular formula C23H44O3 and a molecular weight of 368.60 g/mol. Its IUPAC name is (1-cyclohexyloxy-3,3-dimethylbutyl) 2-tert-butyl-2,4-dimethylpentanoate.
| Compound Name | (1-cyclohexyloxy-3,3-dimethylbutyl) 2-tert-butyl-2,4-dimethylpentanoate |
|---|---|
| PubChem CID | 144560546 |
| Molecular Formula | C23H44O3 |
| Molecular Weight | 368.60 g/mol |
| Exact Mass | 368.33 |
| IUPAC Name | (1-cyclohexyloxy-3,3-dimethylbutyl) 2-tert-butyl-2,4-dimethylpentanoate |
| SMILES | CC(C)CC(C)(C(=O)OC(CC(C)(C)C)OC1CCCCC1)C(C)(C)C |
| InChI | InChI=1S/C23H44O3/c1-17(2)15-23(9,22(6,7)8)20(24)26-19(16-21(3,4)5)25-18-13-11-10-12-14-18/h17-19H,10-16H2,1-9H3 |
| InChIKey | XDJGRWYRXAFQKD-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.60 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|