C20H37F3O3 — CID 169429935
butan-2-yloxycyclohexane;tert-butyl 2-methyl-2-(trifluoromethyl)butanoate (PubChem CID 169429935) has the molecular formula C20H37F3O3 and a molecular weight of 382.51 g/mol. Its IUPAC name is butan-2-yloxycyclohexane;tert-butyl 2-methyl-2-(trifluoromethyl)butanoate.
| Compound Name | butan-2-yloxycyclohexane;tert-butyl 2-methyl-2-(trifluoromethyl)butanoate |
|---|---|
| PubChem CID | 169429935 |
| Molecular Formula | C20H37F3O3 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.27 |
| IUPAC Name | butan-2-yloxycyclohexane;tert-butyl 2-methyl-2-(trifluoromethyl)butanoate |
| SMILES | CCC(C)(C(=O)OC(C)(C)C)C(F)(F)F.CCC(C)OC1CCCCC1 |
| InChI | InChI=1S/C10H17F3O2.C10H20O/c1-6-9(5,10(11,12)13)7(14)15-8(2,3)4;1-3-9(2)11-10-7-5-4-6-8-10/h6H2,1-5H3;9-10H,3-8H2,1-2H3 |
| InChIKey | SPJNBZJTNZYUSM-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |