C25H44O6 — CID 22944820
1-O,2-O-ditert-butyl 4-O-cyclohexyl 2,4-dimethylhexane-1,2,4-tricarboxylate (PubChem CID 22944820) has the molecular formula C25H44O6 and a molecular weight of 440.62 g/mol. Its IUPAC name is 1-O,2-O-ditert-butyl 4-O-cyclohexyl 2,4-dimethylhexane-1,2,4-tricarboxylate.
| Compound Name | 1-O,2-O-ditert-butyl 4-O-cyclohexyl 2,4-dimethylhexane-1,2,4-tricarboxylate |
|---|---|
| PubChem CID | 22944820 |
| Molecular Formula | C25H44O6 |
| Molecular Weight | 440.62 g/mol |
| Exact Mass | 440.31 |
| IUPAC Name | 1-O,2-O-ditert-butyl 4-O-cyclohexyl 2,4-dimethylhexane-1,2,4-tricarboxylate |
| SMILES | CCC(C)(CC(C)(CC(=O)OC(C)(C)C)C(=O)OC(C)(C)C)C(=O)OC1CCCCC1 |
| InChI | InChI=1S/C25H44O6/c1-10-24(8,20(27)29-18-14-12-11-13-15-18)17-25(9,21(28)31-23(5,6)7)16-19(26)30-22(2,3)4/h18H,10-17H2,1-9H3 |
| InChIKey | VGENBJKJKDWVJX-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.62 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|