C29H54N2O4 — CID 145333560
bis(2,2,6,6-tetramethylpiperidin-4-yl) 2,4-diethyl-2,4-dimethylpentanedioate (PubChem CID 145333560) has the molecular formula C29H54N2O4 and a molecular weight of 494.76 g/mol. Its IUPAC name is bis(2,2,6,6-tetramethylpiperidin-4-yl) 2,4-diethyl-2,4-dimethylpentanedioate.
| Compound Name | bis(2,2,6,6-tetramethylpiperidin-4-yl) 2,4-diethyl-2,4-dimethylpentanedioate |
|---|---|
| PubChem CID | 145333560 |
| Molecular Formula | C29H54N2O4 |
| Molecular Weight | 494.76 g/mol |
| Exact Mass | 494.41 |
| IUPAC Name | bis(2,2,6,6-tetramethylpiperidin-4-yl) 2,4-diethyl-2,4-dimethylpentanedioate |
| SMILES | CCC(C)(CC(C)(CC)C(=O)OC1CC(C)(C)NC(C)(C)C1)C(=O)OC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C29H54N2O4/c1-13-28(11,22(32)34-20-15-24(3,4)30-25(5,6)16-20)19-29(12,14-2)23(33)35-21-17-26(7,8)31-27(9,10)18-21/h20-21,30-31H,13-19H2,1-12H3 |
| InChIKey | IIRMCPAMEVPCIW-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.76 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |