C23H42N2O4 — CID 139985901
bis(2,2,6,6-tetramethylpiperidin-4-yl) 2,2-dimethylpropanedioate (PubChem CID 139985901) has the molecular formula C23H42N2O4 and a molecular weight of 410.60 g/mol. Its IUPAC name is bis(2,2,6,6-tetramethylpiperidin-4-yl) 2,2-dimethylpropanedioate.
| Compound Name | bis(2,2,6,6-tetramethylpiperidin-4-yl) 2,2-dimethylpropanedioate |
|---|---|
| PubChem CID | 139985901 |
| Molecular Formula | C23H42N2O4 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.31 |
| IUPAC Name | bis(2,2,6,6-tetramethylpiperidin-4-yl) 2,2-dimethylpropanedioate |
| SMILES | CC1(C)CC(OC(=O)C(C)(C)C(=O)OC2CC(C)(C)NC(C)(C)C2)CC(C)(C)N1 |
| InChI | InChI=1S/C23H42N2O4/c1-19(2)11-15(12-20(3,4)24-19)28-17(26)23(9,10)18(27)29-16-13-21(5,6)25-22(7,8)14-16/h15-16,24-25H,11-14H2,1-10H3 |
| InChIKey | KHPLPPFXPYVMMB-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|