C42H72N4O8 — CID 22761497
tetrakis(2,2,6,6-tetramethylpiperidin-4-yl) ethene-1,1,2,2-tetracarboxylate (PubChem CID 22761497) has the molecular formula C42H72N4O8 and a molecular weight of 761.06 g/mol. Its IUPAC name is tetrakis(2,2,6,6-tetramethylpiperidin-4-yl) ethene-1,1,2,2-tetracarboxylate.
| Compound Name | tetrakis(2,2,6,6-tetramethylpiperidin-4-yl) ethene-1,1,2,2-tetracarboxylate |
|---|---|
| PubChem CID | 22761497 |
| Molecular Formula | C42H72N4O8 |
| Molecular Weight | 761.06 g/mol |
| Exact Mass | 760.54 |
| IUPAC Name | tetrakis(2,2,6,6-tetramethylpiperidin-4-yl) ethene-1,1,2,2-tetracarboxylate |
| SMILES | CC1(C)CC(OC(=O)C(C(=O)OC2CC(C)(C)NC(C)(C)C2)=C(C(=O)OC2CC(C)(C)NC(C)(C)C2)C(=O)OC2CC(C)(C)NC(C)(C)C2)CC(C)(C)N1 |
| InChI | InChI=1S/C42H72N4O8/c1-35(2)17-25(18-36(3,4)43-35)51-31(47)29(32(48)52-26-19-37(5,6)44-38(7,8)20-26)30(33(49)53-27-21-39(9,10)45-40(11,12)22-27)34(50)54-28-23-41(13,14)46-42(15,16)24-28/h25-28,43-46H,17-24H2,1-16H3 |
| InChIKey | QKRCZHIEPDXIAB-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 153.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.06 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|