C11H19Br2NO2 — CID 162509434
(2,2,6,6-tetramethylpiperidin-4-yl) 2,2-dibromoacetate (PubChem CID 162509434) has the molecular formula C11H19Br2NO2 and a molecular weight of 357.09 g/mol. Its IUPAC name is (2,2,6,6-tetramethylpiperidin-4-yl) 2,2-dibromoacetate.
| Compound Name | (2,2,6,6-tetramethylpiperidin-4-yl) 2,2-dibromoacetate |
|---|---|
| PubChem CID | 162509434 |
| Molecular Formula | C11H19Br2NO2 |
| Molecular Weight | 357.09 g/mol |
| Exact Mass | 354.98 |
| IUPAC Name | (2,2,6,6-tetramethylpiperidin-4-yl) 2,2-dibromoacetate |
| SMILES | CC1(C)CC(OC(=O)C(Br)Br)CC(C)(C)N1 |
| InChI | InChI=1S/C11H19Br2NO2/c1-10(2)5-7(6-11(3,4)14-10)16-9(15)8(12)13/h7-8,14H,5-6H2,1-4H3 |
| InChIKey | DRQZMKMCVRQIMG-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.09 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|