C30H57N2O4+ — CID 153184887
[1-(2,2,6,6-tetramethylpiperidin-4-yl)oxy-9-(2,2,6,6-tetramethylpiperidin-4-yl)oxycarbonylundecylidene]oxidanium (PubChem CID 153184887) has the molecular formula C30H57N2O4+ and a molecular weight of 509.80 g/mol. Its IUPAC name is [1-(2,2,6,6-tetramethylpiperidin-4-yl)oxy-9-(2,2,6,6-tetramethylpiperidin-4-yl)oxycarbonylundecylidene]oxidanium.
| Compound Name | [1-(2,2,6,6-tetramethylpiperidin-4-yl)oxy-9-(2,2,6,6-tetramethylpiperidin-4-yl)oxycarbonylundecylidene]oxidanium |
|---|---|
| PubChem CID | 153184887 |
| Molecular Formula | C30H57N2O4+ |
| Molecular Weight | 509.80 g/mol |
| Exact Mass | 509.43 |
| IUPAC Name | [1-(2,2,6,6-tetramethylpiperidin-4-yl)oxy-9-(2,2,6,6-tetramethylpiperidin-4-yl)oxycarbonylundecylidene]oxidanium |
| SMILES | [H]/[O+]=C(\CCCCCCCC(CC)C(=O)OC1CC(C)(C)NC(C)(C)C1)OC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C30H56N2O4/c1-10-22(26(34)36-24-20-29(6,7)32-30(8,9)21-24)16-14-12-11-13-15-17-25(33)35-23-18-27(2,3)31-28(4,5)19-23/h22-24,31-32H,10-21H2,1-9H3/p+1 |
| InChIKey | WGWRYIATJOHOTJ-UHFFFAOYSA-O |
| XLogP | 6.42 |
| TPSA | 80.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.80 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|